C15H15F3N2O2S — CID 175749214
2-(trideuteriomethyl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide (PubChem CID 175749214) has the molecular formula C15H15F3N2O2S and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-(trideuteriomethyl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide.
| Compound Name | 2-(trideuteriomethyl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 175749214 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(trideuteriomethyl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
| SMILES | [2H]C([2H])([2H])c1cc(NCc2ccc(C(F)(F)F)cc2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C15H15F3N2O2S/c1-10-8-13(6-7-14(10)23(19,21)22)20-9-11-2-4-12(5-3-11)15(16,17)18/h2-8,20H,9H2,1H3,(H2,19,21,22)/i1D3 |
| InChIKey | XEPBOUBBEIIKNC-FIBGUPNXSA-N |
| XLogP | 3.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |