C16H13BrF6N2O2S — CID 164595988
2-(1-bromo-2,2,2-trifluoroethyl)-5-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide (PubChem CID 164595988) has the molecular formula C16H13BrF6N2O2S and a molecular weight of 491.25 g/mol. Its IUPAC name is 2-(1-bromo-2,2,2-trifluoroethyl)-5-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide.
| Compound Name | 2-(1-bromo-2,2,2-trifluoroethyl)-5-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 164595988 |
| Molecular Formula | C16H13BrF6N2O2S |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-(1-bromo-2,2,2-trifluoroethyl)-5-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(NCc2ccc(C(F)(F)F)cc2)ccc1C(Br)C(F)(F)F |
| InChI | InChI=1S/C16H13BrF6N2O2S/c17-14(16(21,22)23)12-6-5-11(7-13(12)28(24,26)27)25-8-9-1-3-10(4-2-9)15(18,19)20/h1-7,14,25H,8H2,(H2,24,26,27) |
| InChIKey | IRFVJELKAUEHIM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|