C14H12F4N2O2S — CID 86780500
3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide (PubChem CID 86780500) has the molecular formula C14H12F4N2O2S and a molecular weight of 348.32 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide.
| Compound Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 86780500 |
| Molecular Formula | C14H12F4N2O2S |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H12F4N2O2S/c15-11-5-9(4-10(6-11)14(16,17)18)8-20-12-2-1-3-13(7-12)23(19,21)22/h1-7,20H,8H2,(H2,19,21,22) |
| InChIKey | SEPNGMNJSZKBRX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |