C12H22N2O2S — CID 159144655
3-(2,2-dimethylpropylamino)benzenesulfonamide;methane (PubChem CID 159144655) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)benzenesulfonamide;methane.
| Compound Name | 3-(2,2-dimethylpropylamino)benzenesulfonamide;methane |
|---|---|
| PubChem CID | 159144655 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)benzenesulfonamide;methane |
| SMILES | C.CC(C)(C)CNc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O2S.CH4/c1-11(2,3)8-13-9-5-4-6-10(7-9)16(12,14)15;/h4-7,13H,8H2,1-3H3,(H2,12,14,15);1H4 |
| InChIKey | KINKAFNUFANHKD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |