C12H20N2O4S2 — CID 103727879
3-(3,3-dimethylbutylsulfonylamino)benzenesulfonamide (PubChem CID 103727879) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(3,3-dimethylbutylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-(3,3-dimethylbutylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 103727879 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-(3,3-dimethylbutylsulfonylamino)benzenesulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-12(2,3)7-8-19(15,16)14-10-5-4-6-11(9-10)20(13,17)18/h4-6,9,14H,7-8H2,1-3H3,(H2,13,17,18) |
| InChIKey | DBUPOFVOEXAGFW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |