C8H13N3O4S2 — CID 114812411
3-(ethylsulfamoylamino)benzenesulfonamide (PubChem CID 114812411) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(ethylsulfamoylamino)benzenesulfonamide.
| Compound Name | 3-(ethylsulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114812411 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 3-(ethylsulfamoylamino)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H13N3O4S2/c1-2-10-17(14,15)11-7-4-3-5-8(6-7)16(9,12)13/h3-6,10-11H,2H2,1H3,(H2,9,12,13) |
| InChIKey | NIIQORAKMJSZBA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |