C12H12N2O5S2 — CID 81264911
3-[(3-hydroxyphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 81264911) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 3-[(3-hydroxyphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 81264911 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 3-[(3-hydroxyphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NS(=O)(=O)c2cccc(O)c2)c1 |
| InChI | InChI=1S/C12H12N2O5S2/c13-20(16,17)11-5-1-3-9(7-11)14-21(18,19)12-6-2-4-10(15)8-12/h1-8,14-15H,(H2,13,16,17) |
| InChIKey | VKJSFMOMEQXLKL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |