C25H18N2O7S2 — CID 10075434
2-N,7-N-bis(3-hydroxyphenyl)-9-oxofluorene-2,7-disulfonamide (PubChem CID 10075434) has the molecular formula C25H18N2O7S2 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-N,7-N-bis(3-hydroxyphenyl)-9-oxofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(3-hydroxyphenyl)-9-oxofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 10075434 |
| Molecular Formula | C25H18N2O7S2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-N,7-N-bis(3-hydroxyphenyl)-9-oxofluorene-2,7-disulfonamide |
| SMILES | O=C1c2cc(S(=O)(=O)Nc3cccc(O)c3)ccc2-c2ccc(S(=O)(=O)Nc3cccc(O)c3)cc21 |
| InChI | InChI=1S/C25H18N2O7S2/c28-17-5-1-3-15(11-17)26-35(31,32)19-7-9-21-22-10-8-20(14-24(22)25(30)23(21)13-19)36(33,34)27-16-4-2-6-18(29)12-16/h1-14,26-29H |
| InChIKey | FCYXQUQRBNMREF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |