C27H19N2O8S2- — CID 23436602
2-[2,7-bis[(3-hydroxyphenyl)sulfamoyl]fluoren-9-ylidene]acetate (PubChem CID 23436602) has the molecular formula C27H19N2O8S2- and a molecular weight of 563.59 g/mol. Its IUPAC name is 2-[2,7-bis[(3-hydroxyphenyl)sulfamoyl]fluoren-9-ylidene]acetate.
| Compound Name | 2-[2,7-bis[(3-hydroxyphenyl)sulfamoyl]fluoren-9-ylidene]acetate |
|---|---|
| PubChem CID | 23436602 |
| Molecular Formula | C27H19N2O8S2- |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | 2-[2,7-bis[(3-hydroxyphenyl)sulfamoyl]fluoren-9-ylidene]acetate |
| SMILES | O=C([O-])C=C1c2cc(S(=O)(=O)Nc3cccc(O)c3)ccc2-c2ccc(S(=O)(=O)Nc3cccc(O)c3)cc21 |
| InChI | InChI=1S/C27H20N2O8S2/c30-18-5-1-3-16(11-18)28-38(34,35)20-7-9-22-23-10-8-21(14-25(23)26(15-27(32)33)24(22)13-20)39(36,37)29-17-4-2-6-19(31)12-17/h1-15,28-31H,(H,32,33)/p-1 |
| InChIKey | AFIUQCPKFOFNKG-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 172.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|