C13H12N2O5S — CID 130406151
2-hydroxy-5-[(3-hydroxyphenyl)sulfamoyl]benzamide (PubChem CID 130406151) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-hydroxy-5-[(3-hydroxyphenyl)sulfamoyl]benzamide.
| Compound Name | 2-hydroxy-5-[(3-hydroxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 130406151 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-hydroxy-5-[(3-hydroxyphenyl)sulfamoyl]benzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)Nc2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C13H12N2O5S/c14-13(18)11-7-10(4-5-12(11)17)21(19,20)15-8-2-1-3-9(16)6-8/h1-7,15-17H,(H2,14,18) |
| InChIKey | DCHDYBJMSGTDIT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |