C19H17N3O6S2 — CID 130406327
5-[[3-(benzenesulfonamido)phenyl]sulfamoyl]-2-hydroxybenzamide (PubChem CID 130406327) has the molecular formula C19H17N3O6S2 and a molecular weight of 447.49 g/mol. Its IUPAC name is 5-[[3-(benzenesulfonamido)phenyl]sulfamoyl]-2-hydroxybenzamide.
| Compound Name | 5-[[3-(benzenesulfonamido)phenyl]sulfamoyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 130406327 |
| Molecular Formula | C19H17N3O6S2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 5-[[3-(benzenesulfonamido)phenyl]sulfamoyl]-2-hydroxybenzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)Nc2cccc(NS(=O)(=O)c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C19H17N3O6S2/c20-19(24)17-12-16(9-10-18(17)23)30(27,28)22-14-6-4-5-13(11-14)21-29(25,26)15-7-2-1-3-8-15/h1-12,21-23H,(H2,20,24) |
| InChIKey | CIDJEXWDIAJWBR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |