C14H15N3O6S2 — CID 130406205
2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]benzamide (PubChem CID 130406205) has the molecular formula C14H15N3O6S2 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]benzamide.
| Compound Name | 2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 130406205 |
| Molecular Formula | C14H15N3O6S2 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(NS(=O)(=O)c2ccc(O)c(C(N)=O)c2)c1 |
| InChI | InChI=1S/C14H15N3O6S2/c1-24(20,21)16-9-3-2-4-10(7-9)17-25(22,23)11-5-6-13(18)12(8-11)14(15)19/h2-8,16-18H,1H3,(H2,15,19) |
| InChIKey | NMTXZHMSJYQTEW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |