C16H17N7O5S2 — CID 172978978
(1Z)-2-amino-N-[2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978978) has the molecular formula C16H17N7O5S2 and a molecular weight of 451.49 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978978 |
| Molecular Formula | C16H17N7O5S2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | (1Z)-2-amino-N-[2-hydroxy-5-[[3-(methanesulfonamido)phenyl]sulfamoyl]anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(S(=O)(=O)Nc2cccc(NS(C)(=O)=O)c2)ccc1O |
| InChI | InChI=1S/C16H17N7O5S2/c1-29(25,26)22-10-3-2-4-11(7-10)23-30(27,28)12-5-6-15(24)13(8-12)20-21-14(9-17)16(18)19/h2-8,20,22-24H,1H3,(H3,18,19)/b21-14+ |
| InChIKey | ACLIOENSCMFNCZ-KGENOOAVSA-N |
| XLogP | 0.79 |
| TPSA | 210.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|