C16H16N6O3S — CID 172978050
(1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)sulfamoyl]anilino]ethanimidoyl cyanide (PubChem CID 172978050) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)sulfamoyl]anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)sulfamoyl]anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978050 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)sulfamoyl]anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(S(=O)(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C16H16N6O3S/c1-25-13-7-5-11(6-8-13)22-26(23,24)14-4-2-3-12(9-14)20-21-15(10-17)16(18)19/h2-9,20,22H,1H3,(H3,18,19)/b21-15+ |
| InChIKey | ZJOAUOOSYCQHIL-RCCKNPSSSA-N |
| XLogP | 1.72 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|