C13H15N5O2 — CID 172931870
propan-2-yl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoate (PubChem CID 172931870) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is propan-2-yl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoate.
| Compound Name | propan-2-yl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 172931870 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | propan-2-yl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C13H15N5O2/c1-8(2)20-13(19)9-4-3-5-10(6-9)17-18-11(7-14)12(15)16/h3-6,8,17H,1-2H3,(H3,15,16)/b18-11+ |
| InChIKey | UAXQPKWMXAREGS-WOJGMQOQSA-N |
| XLogP | 1.48 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|