C19H19N5O2 — CID 172977339
propan-2-yl 4-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]benzoate (PubChem CID 172977339) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is propan-2-yl 4-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]benzoate.
| Compound Name | propan-2-yl 4-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]benzoate |
|---|---|
| PubChem CID | 172977339 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | propan-2-yl 4-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]benzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(-c2ccc(C(=O)OC(C)C)cc2)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-12(2)26-19(25)14-8-6-13(7-9-14)15-4-3-5-16(10-15)23-24-17(11-20)18(21)22/h3-10,12,23H,1-2H3,(H3,21,22)/b24-17+ |
| InChIKey | OHHIEEKVOCHLPF-JJIBRWJFSA-N |
| XLogP | 3.15 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|