C14H13N7O2 — CID 172978184
methyl 3-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-1H-pyrazole-5-carboxylate (PubChem CID 172978184) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is methyl 3-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 3-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 172978184 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | methyl 3-[3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-1H-pyrazole-5-carboxylate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(-c2cc(C(=O)OC)[nH]n2)c1 |
| InChI | InChI=1S/C14H13N7O2/c1-23-14(22)11-6-10(19-20-11)8-3-2-4-9(5-8)18-21-12(7-15)13(16)17/h2-6,18H,1H3,(H3,16,17)(H,19,20)/b21-12+ |
| InChIKey | ZUSVNHAXEAUORQ-CIAFOILYSA-N |
| XLogP | 1.09 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|