C17H16N6O2 — CID 172976313
(1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)carbamoyl]anilino]ethanimidoyl cyanide (PubChem CID 172976313) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)carbamoyl]anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)carbamoyl]anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976313 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-[(4-methoxyphenyl)carbamoyl]anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(C(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C17H16N6O2/c1-25-14-7-5-12(6-8-14)21-17(24)11-3-2-4-13(9-11)22-23-15(10-18)16(19)20/h2-9,22H,1H3,(H3,19,20)(H,21,24)/b23-15+ |
| InChIKey | AJMRACWCFZSATM-HZHRSRAPSA-N |
| XLogP | 2.17 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|