C23H18N8O — CID 172977651
(1Z)-2-amino-N-[[2-(4-benzamidophenyl)-3H-benzimidazol-5-yl]amino]-2-iminoethanimidoyl cyanide (PubChem CID 172977651) has the molecular formula C23H18N8O and a molecular weight of 422.45 g/mol. Its IUPAC name is (1Z)-2-amino-N-[[2-(4-benzamidophenyl)-3H-benzimidazol-5-yl]amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[[2-(4-benzamidophenyl)-3H-benzimidazol-5-yl]amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977651 |
| Molecular Formula | C23H18N8O |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (1Z)-2-amino-N-[[2-(4-benzamidophenyl)-3H-benzimidazol-5-yl]amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2nc(-c3ccc(NC(=O)c4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H18N8O/c24-13-20(21(25)26)31-30-17-10-11-18-19(12-17)29-22(28-18)14-6-8-16(9-7-14)27-23(32)15-4-2-1-3-5-15/h1-12,30H,(H3,25,26)(H,27,32)(H,28,29)/b31-20+ |
| InChIKey | KWWWPKRHGLYYPD-AJBULDERSA-N |
| XLogP | 3.71 |
| TPSA | 155.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|