C25H15N7O — CID 168608096
N-[4-[6-(1,2,2-tricyanoethenylamino)-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 168608096) has the molecular formula C25H15N7O and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[4-[6-(1,2,2-tricyanoethenylamino)-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[6-(1,2,2-tricyanoethenylamino)-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 168608096 |
| Molecular Formula | C25H15N7O |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[4-[6-(1,2,2-tricyanoethenylamino)-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc2nc(-c3ccc(NC(=O)c4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H15N7O/c26-13-18(14-27)23(15-28)29-20-10-11-21-22(12-20)32-24(31-21)16-6-8-19(9-7-16)30-25(33)17-4-2-1-3-5-17/h1-12,29H,(H,30,33)(H,31,32) |
| InChIKey | HHFJXUQOITYVKI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|