C16H12BrN7 — CID 172978953
(1Z)-2-amino-N-[3-(6-bromo-1H-benzimidazol-2-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978953) has the molecular formula C16H12BrN7 and a molecular weight of 382.23 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-(6-bromo-1H-benzimidazol-2-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-(6-bromo-1H-benzimidazol-2-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978953 |
| Molecular Formula | C16H12BrN7 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (1Z)-2-amino-N-[3-(6-bromo-1H-benzimidazol-2-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(-c2nc3ccc(Br)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H12BrN7/c17-10-4-5-12-13(7-10)22-16(21-12)9-2-1-3-11(6-9)23-24-14(8-18)15(19)20/h1-7,23H,(H3,19,20)(H,21,22)/b24-14+ |
| InChIKey | FQITVBWFRXCFHP-ZVHZXABRSA-N |
| XLogP | 3.22 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|