C18H14N6S — CID 172979286
(1Z)-2-amino-2-imino-N-[3-(2-phenyl-1,3-thiazol-4-yl)anilino]ethanimidoyl cyanide (PubChem CID 172979286) has the molecular formula C18H14N6S and a molecular weight of 346.42 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-(2-phenyl-1,3-thiazol-4-yl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-(2-phenyl-1,3-thiazol-4-yl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979286 |
| Molecular Formula | C18H14N6S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-(2-phenyl-1,3-thiazol-4-yl)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(-c2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H14N6S/c19-10-15(17(20)21)24-23-14-8-4-7-13(9-14)16-11-25-18(22-16)12-5-2-1-3-6-12/h1-9,11,23H,(H3,20,21)/b24-15+ |
| InChIKey | JVCNIRCRODVSIX-BUVRLJJBSA-N |
| XLogP | 3.70 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|