C18H11N5S — CID 169340937
2-[[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340937) has the molecular formula C18H11N5S and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340937 |
| Molecular Formula | C18H11N5S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cccc(-c2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H11N5S/c19-10-16(11-20)23-22-15-8-4-7-14(9-15)17-12-24-18(21-17)13-5-2-1-3-6-13/h1-9,12,22H |
| InChIKey | DUEBZYCYMYBUTM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|