C19H13N5S — CID 169340608
2-[[3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340608) has the molecular formula C19H13N5S and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[[3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340608 |
| Molecular Formula | C19H13N5S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[[3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | Cc1sc(-c2cccc(NN=C(C#N)C#N)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H13N5S/c1-13-18(14-6-3-2-4-7-14)22-19(25-13)15-8-5-9-16(10-15)23-24-17(11-20)12-21/h2-10,23H,1H3 |
| InChIKey | POCXCFCYXCIHRB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|