C17H13F3N6 — CID 169338259
2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169338259) has the molecular formula C17H13F3N6 and a molecular weight of 358.33 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338259 |
| Molecular Formula | C17H13F3N6 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]phenyl]hydrazinylidene]propanedinitrile |
| SMILES | CN(C)c1ncc(C(F)(F)F)cc1-c1cccc(NN=C(C#N)C#N)c1 |
| InChI | InChI=1S/C17H13F3N6/c1-26(2)16-15(7-12(10-23-16)17(18,19)20)11-4-3-5-13(6-11)24-25-14(8-21)9-22/h3-7,10,24H,1-2H3 |
| InChIKey | KTULNSWCZJIYRG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|