C18H15F3N8 — CID 169344740
3-[4-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344740) has the molecular formula C18H15F3N8 and a molecular weight of 400.37 g/mol. Its IUPAC name is 3-[4-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344740 |
| Molecular Formula | C18H15F3N8 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[4-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CN(C)c1ncc(C(F)(F)F)cc1-c1ccc(NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H15F3N8/c1-29(2)17-15(7-13(10-24-17)18(19,20)21)11-3-5-14(6-4-11)23-9-12(8-22)16-25-27-28-26-16/h3-7,9-10,23H,1-2H3,(H,25,26,27,28) |
| InChIKey | IYBXNFPSLGLENO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|