C18H14F3N5 — CID 168541977
2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]methylidene]propanedinitrile (PubChem CID 168541977) has the molecular formula C18H14F3N5 and a molecular weight of 357.34 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168541977 |
| Molecular Formula | C18H14F3N5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]anilino]methylidene]propanedinitrile |
| SMILES | CN(C)c1ncc(C(F)(F)F)cc1-c1cccc(NC=C(C#N)C#N)c1 |
| InChI | InChI=1S/C18H14F3N5/c1-26(2)17-16(7-14(11-25-17)18(19,20)21)13-4-3-5-15(6-13)24-10-12(8-22)9-23/h3-7,10-11,24H,1-2H3 |
| InChIKey | QEPOUBPCCPZUKK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|