C15H6Cl2F3N5O — CID 169340160
2-[[3-chloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340160) has the molecular formula C15H6Cl2F3N5O and a molecular weight of 400.15 g/mol. Its IUPAC name is 2-[[3-chloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340160 |
| Molecular Formula | C15H6Cl2F3N5O |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-[[3-chloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H6Cl2F3N5O/c16-11-4-9(24-25-10(5-21)6-22)1-2-13(11)26-14-12(17)3-8(7-23-14)15(18,19)20/h1-4,7,24H |
| InChIKey | HYXPAOHRWXAXAH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|