C17H13ClN4O — CID 169339212
2-[[3-chloro-4-(3,4-dimethylphenoxy)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339212) has the molecular formula C17H13ClN4O and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[[3-chloro-4-(3,4-dimethylphenoxy)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-4-(3,4-dimethylphenoxy)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339212 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[[3-chloro-4-(3,4-dimethylphenoxy)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | Cc1ccc(Oc2ccc(NN=C(C#N)C#N)cc2Cl)cc1C |
| InChI | InChI=1S/C17H13ClN4O/c1-11-3-5-15(7-12(11)2)23-17-6-4-13(8-16(17)18)21-22-14(9-19)10-20/h3-8,21H,1-2H3 |
| InChIKey | CXZSKYYKHBAGMG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|