C11H4N6 — CID 169337793
4-[2-(dicyanomethylidene)hydrazinyl]benzene-1,2-dicarbonitrile (PubChem CID 169337793) has the molecular formula C11H4N6 and a molecular weight of 220.19 g/mol. Its IUPAC name is 4-[2-(dicyanomethylidene)hydrazinyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-(dicyanomethylidene)hydrazinyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169337793 |
| Molecular Formula | C11H4N6 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-[2-(dicyanomethylidene)hydrazinyl]benzene-1,2-dicarbonitrile |
| SMILES | N#CC(C#N)=NNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C11H4N6/c12-4-8-1-2-10(3-9(8)5-13)16-17-11(6-14)7-15/h1-3,16H |
| InChIKey | GMOCFTXBERFRBP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|