C17H8N6O — CID 169337735
4-[4-[2-(dicyanomethylidene)hydrazinyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 169337735) has the molecular formula C17H8N6O and a molecular weight of 312.29 g/mol. Its IUPAC name is 4-[4-[2-(dicyanomethylidene)hydrazinyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[2-(dicyanomethylidene)hydrazinyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169337735 |
| Molecular Formula | C17H8N6O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-[4-[2-(dicyanomethylidene)hydrazinyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#CC(C#N)=NNc1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
| InChI | InChI=1S/C17H8N6O/c18-8-12-1-4-17(7-13(12)9-19)24-16-5-2-14(3-6-16)22-23-15(10-20)11-21/h1-7,22H |
| InChIKey | AJFWXBOEFRYOSF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|