C17H15N3O3 — CID 168594427
4-[4-(2,3-dihydroxypropylamino)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 168594427) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 168594427 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(NCC(O)CO)cc2)cc1C#N |
| InChI | InChI=1S/C17H15N3O3/c18-8-12-1-4-17(7-13(12)9-19)23-16-5-2-14(3-6-16)20-10-15(22)11-21/h1-7,15,20-22H,10-11H2 |
| InChIKey | KPZDPVREDYKWNW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |