C16H17NO5 — CID 168594183
4-[4-(2,3-dihydroxypropylamino)phenoxy]benzoic acid (PubChem CID 168594183) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzoic acid.
| Compound Name | 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 168594183 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-[4-(2,3-dihydroxypropylamino)phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(NCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C16H17NO5/c18-10-13(19)9-17-12-3-7-15(8-4-12)22-14-5-1-11(2-6-14)16(20)21/h1-8,13,17-19H,9-10H2,(H,20,21) |
| InChIKey | SXHLHHPZRJZXIB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |