C11H15NO4 — CID 82095820
2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid (PubChem CID 82095820) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid.
| Compound Name | 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 82095820 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NCC(O)CO)cc1 |
| InChI | InChI=1S/C11H15NO4/c13-7-10(14)6-12-9-3-1-8(2-4-9)5-11(15)16/h1-4,10,12-14H,5-7H2,(H,15,16) |
| InChIKey | DJJWDQZUJCHXCM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |