2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid

C11H15NO4 — CID 82095820

IUPAC2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NCC(O)CO)cc1
InChIInChI=1S/C11H15NO4/c13-7-10(14)6-12-9-3-1-8(2-4-9)5-11(15)16/h1-4,10,12-14H,5-7H2,(H,15,16)
InChIKeyDJJWDQZUJCHXCM-UHFFFAOYSA-N
MW225.24 g/mol
LogP0.08
Rot. Bonds6

About 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid

2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid (PubChem CID 82095820) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid
PubChem CID82095820
Molecular FormulaC11H15NO4
Molecular Weight225.24 g/mol
Exact Mass225.10
IUPAC Name2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NCC(O)CO)cc1
InChIInChI=1S/C11H15NO4/c13-7-10(14)6-12-9-3-1-8(2-4-9)5-11(15)16/h1-4,10,12-14H,5-7H2,(H,15,16)
InChIKeyDJJWDQZUJCHXCM-UHFFFAOYSA-N
XLogP0.08
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.24
LogP ≤ 50.08
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid?
The IUPAC name of 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid (CID 82095820) is 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid?
The canonical SMILES for 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid is O=C(O)Cc1ccc(NCC(O)CO)cc1.
What is the InChIKey of 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid?
The InChIKey is DJJWDQZUJCHXCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c13-7-10(14)6-12-9-3-1-8(2-4-9)5-11(15)16/h1-4,10,12-14H,5-7H2,(H,15,16).
What are the key properties of 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid?
2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid has a molecular weight of 225.24 g/mol, XLogP of 0.08, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-dihydroxypropylamino)phenyl]acetic acid is sourced from PubChem (CID 82095820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).