C9H14BNO4 — CID 168597172
[4-(2,3-dihydroxypropylamino)phenyl]boronic acid (PubChem CID 168597172) has the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. Its IUPAC name is [4-(2,3-dihydroxypropylamino)phenyl]boronic acid.
| Compound Name | [4-(2,3-dihydroxypropylamino)phenyl]boronic acid |
|---|---|
| PubChem CID | 168597172 |
| Molecular Formula | C9H14BNO4 |
| Molecular Weight | 211.03 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [4-(2,3-dihydroxypropylamino)phenyl]boronic acid |
| SMILES | OCC(O)CNc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C9H14BNO4/c12-6-9(13)5-11-8-3-1-7(2-4-8)10(14)15/h1-4,9,11-15H,5-6H2 |
| InChIKey | ODNATWTWXIYIAK-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.03 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|