C15H15Cl2NO2 — CID 168593759
3-[4-(3,5-dichlorophenyl)anilino]propane-1,2-diol (PubChem CID 168593759) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 3-[4-(3,5-dichlorophenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-(3,5-dichlorophenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593759 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-[4-(3,5-dichlorophenyl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(-c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H15Cl2NO2/c16-12-5-11(6-13(17)7-12)10-1-3-14(4-2-10)18-8-15(20)9-19/h1-7,15,18-20H,8-9H2 |
| InChIKey | CWXVNKZAFCCFSJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |