C9H11FINO2 — CID 168597274
3-(4-fluoro-3-iodoanilino)propane-1,2-diol (PubChem CID 168597274) has the molecular formula C9H11FINO2 and a molecular weight of 311.09 g/mol. Its IUPAC name is 3-(4-fluoro-3-iodoanilino)propane-1,2-diol.
| Compound Name | 3-(4-fluoro-3-iodoanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168597274 |
| Molecular Formula | C9H11FINO2 |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 3-(4-fluoro-3-iodoanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(F)c(I)c1 |
| InChI | InChI=1S/C9H11FINO2/c10-8-2-1-6(3-9(8)11)12-4-7(14)5-13/h1-3,7,12-14H,4-5H2 |
| InChIKey | MMNASDVQOZXYKA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|