C15H12F5NO2S — CID 168594736
3-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]propane-1,2-diol (PubChem CID 168594736) has the molecular formula C15H12F5NO2S and a molecular weight of 365.32 g/mol. Its IUPAC name is 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]propane-1,2-diol.
| Compound Name | 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594736 |
| Molecular Formula | C15H12F5NO2S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(Sc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H12F5NO2S/c16-10-11(17)13(19)15(14(20)12(10)18)24-9-3-1-7(2-4-9)21-5-8(23)6-22/h1-4,8,21-23H,5-6H2 |
| InChIKey | FGTIEJLWCNYQEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|