C16H16F3NO4S2 — CID 168594855
3-[4-[4-(trifluoromethylsulfanyl)phenyl]sulfonylanilino]propane-1,2-diol (PubChem CID 168594855) has the molecular formula C16H16F3NO4S2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 3-[4-[4-(trifluoromethylsulfanyl)phenyl]sulfonylanilino]propane-1,2-diol.
| Compound Name | 3-[4-[4-(trifluoromethylsulfanyl)phenyl]sulfonylanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594855 |
| Molecular Formula | C16H16F3NO4S2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 3-[4-[4-(trifluoromethylsulfanyl)phenyl]sulfonylanilino]propane-1,2-diol |
| SMILES | O=S(=O)(c1ccc(NCC(O)CO)cc1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO4S2/c17-16(18,19)25-13-3-7-15(8-4-13)26(23,24)14-5-1-11(2-6-14)20-9-12(22)10-21/h1-8,12,20-22H,9-10H2 |
| InChIKey | OILLUUHSSYJPHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |