C10H12F3NO4S — CID 66175657
3-[4-(trifluoromethylsulfonyl)anilino]propane-1,2-diol (PubChem CID 66175657) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-[4-(trifluoromethylsulfonyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-(trifluoromethylsulfonyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 66175657 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[4-(trifluoromethylsulfonyl)anilino]propane-1,2-diol |
| SMILES | O=S(=O)(c1ccc(NCC(O)CO)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4S/c11-10(12,13)19(17,18)9-3-1-7(2-4-9)14-5-8(16)6-15/h1-4,8,14-16H,5-6H2 |
| InChIKey | DHERUYIDJIZOEP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |