C13H19F3N2O2S — CID 115306206
2-ethyl-1-N-[4-(trifluoromethylsulfonyl)phenyl]butane-1,2-diamine (PubChem CID 115306206) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-ethyl-1-N-[4-(trifluoromethylsulfonyl)phenyl]butane-1,2-diamine.
| Compound Name | 2-ethyl-1-N-[4-(trifluoromethylsulfonyl)phenyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 115306206 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-ethyl-1-N-[4-(trifluoromethylsulfonyl)phenyl]butane-1,2-diamine |
| SMILES | CCC(N)(CC)CNc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H19F3N2O2S/c1-3-12(17,4-2)9-18-10-5-7-11(8-6-10)21(19,20)13(14,15)16/h5-8,18H,3-4,9,17H2,1-2H3 |
| InChIKey | GXCXHHGCPCKFKA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |