C12H16F3NO4S — CID 103738506
2-ethyl-2-[4-(trifluoromethylsulfonyl)anilino]propane-1,3-diol (PubChem CID 103738506) has the molecular formula C12H16F3NO4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-ethyl-2-[4-(trifluoromethylsulfonyl)anilino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[4-(trifluoromethylsulfonyl)anilino]propane-1,3-diol |
|---|---|
| PubChem CID | 103738506 |
| Molecular Formula | C12H16F3NO4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-ethyl-2-[4-(trifluoromethylsulfonyl)anilino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO4S/c1-2-11(7-17,8-18)16-9-3-5-10(6-4-9)21(19,20)12(13,14)15/h3-6,16-18H,2,7-8H2,1H3 |
| InChIKey | SMHTVOXONKAAGP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |