C13H19Cl2NO2S — CID 107867414
N-[1-chloro-2-(chloromethyl)butan-2-yl]-4-ethylsulfonylaniline (PubChem CID 107867414) has the molecular formula C13H19Cl2NO2S and a molecular weight of 324.27 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-4-ethylsulfonylaniline.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-4-ethylsulfonylaniline |
|---|---|
| PubChem CID | 107867414 |
| Molecular Formula | C13H19Cl2NO2S |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-4-ethylsulfonylaniline |
| SMILES | CCC(CCl)(CCl)Nc1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C13H19Cl2NO2S/c1-3-13(9-14,10-15)16-11-5-7-12(8-6-11)19(17,18)4-2/h5-8,16H,3-4,9-10H2,1-2H3 |
| InChIKey | KTPOLYPZHKLYDN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|