C14H23NO2S — CID 103462508
N-(2,2-dimethylbutyl)-4-ethylsulfonylaniline (PubChem CID 103462508) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-ethylsulfonylaniline.
| Compound Name | N-(2,2-dimethylbutyl)-4-ethylsulfonylaniline |
|---|---|
| PubChem CID | 103462508 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-ethylsulfonylaniline |
| SMILES | CCC(C)(C)CNc1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C14H23NO2S/c1-5-14(3,4)11-15-12-7-9-13(10-8-12)18(16,17)6-2/h7-10,15H,5-6,11H2,1-4H3 |
| InChIKey | ANLUPNIKFJAECW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |