C15H25NO3S — CID 102846374
1-(4-ethylsulfonylanilino)-4,4-dimethylpentan-2-ol (PubChem CID 102846374) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(4-ethylsulfonylanilino)-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(4-ethylsulfonylanilino)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 102846374 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-(4-ethylsulfonylanilino)-4,4-dimethylpentan-2-ol |
| SMILES | CCS(=O)(=O)c1ccc(NCC(O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3S/c1-5-20(18,19)14-8-6-12(7-9-14)16-11-13(17)10-15(2,3)4/h6-9,13,16-17H,5,10-11H2,1-4H3 |
| InChIKey | UWJUANIVIWYRDD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |