C11H13F4NO2S — CID 106294314
4-ethylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)aniline (PubChem CID 106294314) has the molecular formula C11H13F4NO2S and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)aniline.
| Compound Name | 4-ethylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)aniline |
|---|---|
| PubChem CID | 106294314 |
| Molecular Formula | C11H13F4NO2S |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-ethylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)aniline |
| SMILES | CCS(=O)(=O)c1ccc(NCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H13F4NO2S/c1-2-19(17,18)9-5-3-8(4-6-9)16-7-11(14,15)10(12)13/h3-6,10,16H,2,7H2,1H3 |
| InChIKey | VZRDBKXMOLOUQY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|