C14H22N2O3S — CID 102846503
3-(4-ethylsulfonylanilino)-N,2,2-trimethylpropanamide (PubChem CID 102846503) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-(4-ethylsulfonylanilino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(4-ethylsulfonylanilino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 102846503 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-(4-ethylsulfonylanilino)-N,2,2-trimethylpropanamide |
| SMILES | CCS(=O)(=O)c1ccc(NCC(C)(C)C(=O)NC)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-5-20(18,19)12-8-6-11(7-9-12)16-10-14(2,3)13(17)15-4/h6-9,16H,5,10H2,1-4H3,(H,15,17) |
| InChIKey | XVARYROVOUIFSW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |