C13H22N2O2S — CID 113283230
2-ethyl-1-N-(4-methylsulfonylphenyl)butane-1,2-diamine (PubChem CID 113283230) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-ethyl-1-N-(4-methylsulfonylphenyl)butane-1,2-diamine.
| Compound Name | 2-ethyl-1-N-(4-methylsulfonylphenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 113283230 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-ethyl-1-N-(4-methylsulfonylphenyl)butane-1,2-diamine |
| SMILES | CCC(N)(CC)CNc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O2S/c1-4-13(14,5-2)10-15-11-6-8-12(9-7-11)18(3,16)17/h6-9,15H,4-5,10,14H2,1-3H3 |
| InChIKey | ICQZZYPXVWBMBW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |