C14H23NO3S — CID 97350854
(2S,3R)-2,3-dimethyl-1-(4-methylsulfonylanilino)pentan-2-ol (PubChem CID 97350854) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyl-1-(4-methylsulfonylanilino)pentan-2-ol.
| Compound Name | (2S,3R)-2,3-dimethyl-1-(4-methylsulfonylanilino)pentan-2-ol |
|---|---|
| PubChem CID | 97350854 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2S,3R)-2,3-dimethyl-1-(4-methylsulfonylanilino)pentan-2-ol |
| SMILES | CC[C@@H](C)[C@](C)(O)CNc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23NO3S/c1-5-11(2)14(3,16)10-15-12-6-8-13(9-7-12)19(4,17)18/h6-9,11,15-16H,5,10H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | YRUIXAGMRDAFRD-BXUZGUMPSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |