C12H20N2O2S — CID 115251246
2-ethyl-N'-(4-methylsulfonylphenyl)propane-1,3-diamine (PubChem CID 115251246) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-ethyl-N'-(4-methylsulfonylphenyl)propane-1,3-diamine.
| Compound Name | 2-ethyl-N'-(4-methylsulfonylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115251246 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-ethyl-N'-(4-methylsulfonylphenyl)propane-1,3-diamine |
| SMILES | CCC(CN)CNc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-3-10(8-13)9-14-11-4-6-12(7-5-11)17(2,15)16/h4-7,10,14H,3,8-9,13H2,1-2H3 |
| InChIKey | MHUUBQIQSUSTFP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |